C15H20N2O4 — CID 63657376
2-[[cyclopentylmethyl(methyl)carbamoyl]amino]-5-hydroxybenzoic acid (PubChem CID 63657376) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-[[cyclopentylmethyl(methyl)carbamoyl]amino]-5-hydroxybenzoic acid.
| Compound Name | 2-[[cyclopentylmethyl(methyl)carbamoyl]amino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 63657376 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-[[cyclopentylmethyl(methyl)carbamoyl]amino]-5-hydroxybenzoic acid |
| SMILES | CN(CC1CCCC1)C(=O)Nc1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C15H20N2O4/c1-17(9-10-4-2-3-5-10)15(21)16-13-7-6-11(18)8-12(13)14(19)20/h6-8,10,18H,2-5,9H2,1H3,(H,16,21)(H,19,20) |
| InChIKey | YUWQPSLJSVMNOT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|