C16H30O — CID 6365748
(2E,6E)-11-methoxy-6,11-dimethyltrideca-2,6-diene (PubChem CID 6365748) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is (2E,6E)-11-methoxy-6,11-dimethyltrideca-2,6-diene.
| Compound Name | (2E,6E)-11-methoxy-6,11-dimethyltrideca-2,6-diene |
|---|---|
| PubChem CID | 6365748 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | (2E,6E)-11-methoxy-6,11-dimethyltrideca-2,6-diene |
| SMILES | C/C=C/CC/C(C)=C/CCCC(C)(CC)OC |
| InChI | InChI=1S/C16H30O/c1-6-8-9-12-15(3)13-10-11-14-16(4,7-2)17-5/h6,8,13H,7,9-12,14H2,1-5H3/b8-6+,15-13+ |
| InChIKey | WZXXUCGWWVCQNM-YNYATCQHSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|