C12H12ClF3N2O — CID 63659336
2-amino-6-chloro-N-cyclopropyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 63659336) has the molecular formula C12H12ClF3N2O and a molecular weight of 292.69 g/mol. Its IUPAC name is 2-amino-6-chloro-N-cyclopropyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-amino-6-chloro-N-cyclopropyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 63659336 |
| Molecular Formula | C12H12ClF3N2O |
| Molecular Weight | 292.69 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-amino-6-chloro-N-cyclopropyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | Nc1cccc(Cl)c1C(=O)N(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C12H12ClF3N2O/c13-8-2-1-3-9(17)10(8)11(19)18(7-4-5-7)6-12(14,15)16/h1-3,7H,4-6,17H2 |
| InChIKey | ORBLOTKRGASVAV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.69 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|