C11H15ClN2O4S2 — CID 63660470
N-(4-amino-2-chlorophenyl)-2-(2-methylsulfonylethylsulfinyl)acetamide (PubChem CID 63660470) has the molecular formula C11H15ClN2O4S2 and a molecular weight of 338.84 g/mol. Its IUPAC name is N-(4-amino-2-chlorophenyl)-2-(2-methylsulfonylethylsulfinyl)acetamide.
| Compound Name | N-(4-amino-2-chlorophenyl)-2-(2-methylsulfonylethylsulfinyl)acetamide |
|---|---|
| PubChem CID | 63660470 |
| Molecular Formula | C11H15ClN2O4S2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | N-(4-amino-2-chlorophenyl)-2-(2-methylsulfonylethylsulfinyl)acetamide |
| SMILES | CS(=O)(=O)CCS(=O)CC(=O)Nc1ccc(N)cc1Cl |
| InChI | InChI=1S/C11H15ClN2O4S2/c1-20(17,18)5-4-19(16)7-11(15)14-10-3-2-8(13)6-9(10)12/h2-3,6H,4-5,7,13H2,1H3,(H,14,15) |
| InChIKey | NFPFLCJQGQLVCU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|