2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid

C10H9Cl2NO4S — CID 5102061

IUPAC2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid
SMILESO=C(O)CS(=O)CC(=O)Nc1ccc(Cl)cc1Cl
InChIInChI=1S/C10H9Cl2NO4S/c11-6-1-2-8(7(12)3-6)13-9(14)4-18(17)5-10(15)16/h1-3H,4-5H2,(H,13,14)(H,15,16)
InChIKeyWNTIKQJCPFTHAW-UHFFFAOYSA-N
MW310.16 g/mol
LogP1.77
Rot. Bonds5

About 2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid

2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid (PubChem CID 5102061) has the molecular formula C10H9Cl2NO4S and a molecular weight of 310.16 g/mol. Its IUPAC name is 2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid.

Molecular Properties

Compound Name2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid
PubChem CID5102061
Molecular FormulaC10H9Cl2NO4S
Molecular Weight310.16 g/mol
Exact Mass308.96
IUPAC Name2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid
SMILESO=C(O)CS(=O)CC(=O)Nc1ccc(Cl)cc1Cl
InChIInChI=1S/C10H9Cl2NO4S/c11-6-1-2-8(7(12)3-6)13-9(14)4-18(17)5-10(15)16/h1-3H,4-5H2,(H,13,14)(H,15,16)
InChIKeyWNTIKQJCPFTHAW-UHFFFAOYSA-N
XLogP1.77
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.16
LogP ≤ 51.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid?
The IUPAC name of 2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid (CID 5102061) is 2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid.
What is the SMILES notation for 2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid?
The canonical SMILES for 2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid is O=C(O)CS(=O)CC(=O)Nc1ccc(Cl)cc1Cl.
What is the InChIKey of 2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid?
The InChIKey is WNTIKQJCPFTHAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Cl2NO4S/c11-6-1-2-8(7(12)3-6)13-9(14)4-18(17)5-10(15)16/h1-3H,4-5H2,(H,13,14)(H,15,16).
What are the key properties of 2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid?
2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid has a molecular weight of 310.16 g/mol, XLogP of 1.77, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid is sourced from PubChem (CID 5102061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).