C10H9Cl2NO4S — CID 5102061
2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid (PubChem CID 5102061) has the molecular formula C10H9Cl2NO4S and a molecular weight of 310.16 g/mol. Its IUPAC name is 2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid.
| Compound Name | 2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid |
|---|---|
| PubChem CID | 5102061 |
| Molecular Formula | C10H9Cl2NO4S |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 308.96 |
| IUPAC Name | 2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfinylacetic acid |
| SMILES | O=C(O)CS(=O)CC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H9Cl2NO4S/c11-6-1-2-8(7(12)3-6)13-9(14)4-18(17)5-10(15)16/h1-3H,4-5H2,(H,13,14)(H,15,16) |
| InChIKey | WNTIKQJCPFTHAW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |