C9H6Cl2N2O — CID 108814659
N-(2,4-dichlorophenyl)-2-isocyanoacetamide (PubChem CID 108814659) has the molecular formula C9H6Cl2N2O and a molecular weight of 229.07 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-isocyanoacetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-isocyanoacetamide |
|---|---|
| PubChem CID | 108814659 |
| Molecular Formula | C9H6Cl2N2O |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-isocyanoacetamide |
| SMILES | [C-]#[N+]CC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H6Cl2N2O/c1-12-5-9(14)13-8-3-2-6(10)4-7(8)11/h2-4H,5H2,(H,13,14) |
| InChIKey | ZZSGDIVFFPIVLR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|