C10H11ClFNO3S — CID 97340008
N-(5-chloro-2-fluorophenyl)-2-[(S)-2-hydroxyethylsulfinyl]acetamide (PubChem CID 97340008) has the molecular formula C10H11ClFNO3S and a molecular weight of 279.72 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-2-[(S)-2-hydroxyethylsulfinyl]acetamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)-2-[(S)-2-hydroxyethylsulfinyl]acetamide |
|---|---|
| PubChem CID | 97340008 |
| Molecular Formula | C10H11ClFNO3S |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-2-[(S)-2-hydroxyethylsulfinyl]acetamide |
| SMILES | O=C(C[S@@](=O)CCO)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C10H11ClFNO3S/c11-7-1-2-8(12)9(5-7)13-10(15)6-17(16)4-3-14/h1-2,5,14H,3-4,6H2,(H,13,15)/t17-/m0/s1 |
| InChIKey | KMCLYFDPEWFHHI-KRWDZBQOSA-N |
| XLogP | 1.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |