C13H21NO3S2 — CID 63660617
1-(2-methoxyphenyl)-1-(2-methylsulfonylethylsulfanyl)propan-2-amine (PubChem CID 63660617) has the molecular formula C13H21NO3S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-1-(2-methylsulfonylethylsulfanyl)propan-2-amine.
| Compound Name | 1-(2-methoxyphenyl)-1-(2-methylsulfonylethylsulfanyl)propan-2-amine |
|---|---|
| PubChem CID | 63660617 |
| Molecular Formula | C13H21NO3S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 1-(2-methoxyphenyl)-1-(2-methylsulfonylethylsulfanyl)propan-2-amine |
| SMILES | COc1ccccc1C(SCCS(C)(=O)=O)C(C)N |
| InChI | InChI=1S/C13H21NO3S2/c1-10(14)13(18-8-9-19(3,15)16)11-6-4-5-7-12(11)17-2/h4-7,10,13H,8-9,14H2,1-3H3 |
| InChIKey | IPXPERGXQDOOCZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |