C12H18BrNO2S2 — CID 55246981
1-(3-bromophenyl)-1-(2-methylsulfonylethylsulfanyl)propan-2-amine (PubChem CID 55246981) has the molecular formula C12H18BrNO2S2 and a molecular weight of 352.32 g/mol. Its IUPAC name is 1-(3-bromophenyl)-1-(2-methylsulfonylethylsulfanyl)propan-2-amine.
| Compound Name | 1-(3-bromophenyl)-1-(2-methylsulfonylethylsulfanyl)propan-2-amine |
|---|---|
| PubChem CID | 55246981 |
| Molecular Formula | C12H18BrNO2S2 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 1-(3-bromophenyl)-1-(2-methylsulfonylethylsulfanyl)propan-2-amine |
| SMILES | CC(N)C(SCCS(C)(=O)=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H18BrNO2S2/c1-9(14)12(17-6-7-18(2,15)16)10-4-3-5-11(13)8-10/h3-5,8-9,12H,6-7,14H2,1-2H3 |
| InChIKey | AWWQONNHEPIQMA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |