C15H27ClN2O2 — CID 63665688
N-butyl-1-(3-chloro-2,2-dimethylpropanoyl)piperidine-4-carboxamide (PubChem CID 63665688) has the molecular formula C15H27ClN2O2 and a molecular weight of 302.85 g/mol. Its IUPAC name is N-butyl-1-(3-chloro-2,2-dimethylpropanoyl)piperidine-4-carboxamide.
| Compound Name | N-butyl-1-(3-chloro-2,2-dimethylpropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 63665688 |
| Molecular Formula | C15H27ClN2O2 |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | N-butyl-1-(3-chloro-2,2-dimethylpropanoyl)piperidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CCN(C(=O)C(C)(C)CCl)CC1 |
| InChI | InChI=1S/C15H27ClN2O2/c1-4-5-8-17-13(19)12-6-9-18(10-7-12)14(20)15(2,3)11-16/h12H,4-11H2,1-3H3,(H,17,19) |
| InChIKey | FBMXBTOZINAGSS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|