C10H20ClNO2 — CID 63665899
3-chloro-N-(1-methoxypropan-2-yl)-N,2,2-trimethylpropanamide (PubChem CID 63665899) has the molecular formula C10H20ClNO2 and a molecular weight of 221.73 g/mol. Its IUPAC name is 3-chloro-N-(1-methoxypropan-2-yl)-N,2,2-trimethylpropanamide.
| Compound Name | 3-chloro-N-(1-methoxypropan-2-yl)-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 63665899 |
| Molecular Formula | C10H20ClNO2 |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3-chloro-N-(1-methoxypropan-2-yl)-N,2,2-trimethylpropanamide |
| SMILES | COCC(C)N(C)C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C10H20ClNO2/c1-8(6-14-5)12(4)9(13)10(2,3)7-11/h8H,6-7H2,1-5H3 |
| InChIKey | UHZDAMWANKPWFS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|