C12H14ClF3N2O — CID 63668275
2-[2-chloro-4-(trifluoromethyl)anilino]-N,N-dimethylpropanamide (PubChem CID 63668275) has the molecular formula C12H14ClF3N2O and a molecular weight of 294.70 g/mol. Its IUPAC name is 2-[2-chloro-4-(trifluoromethyl)anilino]-N,N-dimethylpropanamide.
| Compound Name | 2-[2-chloro-4-(trifluoromethyl)anilino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 63668275 |
| Molecular Formula | C12H14ClF3N2O |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-[2-chloro-4-(trifluoromethyl)anilino]-N,N-dimethylpropanamide |
| SMILES | CC(Nc1ccc(C(F)(F)F)cc1Cl)C(=O)N(C)C |
| InChI | InChI=1S/C12H14ClF3N2O/c1-7(11(19)18(2)3)17-10-5-4-8(6-9(10)13)12(14,15)16/h4-7,17H,1-3H3 |
| InChIKey | VNCMFPCNRBJVHE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |