C13H14F2N2OS — CID 63669287
N-[(2,3-difluorophenyl)-(1,3-thiazol-2-yl)methyl]-2-methoxyethanamine (PubChem CID 63669287) has the molecular formula C13H14F2N2OS and a molecular weight of 284.33 g/mol. Its IUPAC name is N-[(2,3-difluorophenyl)-(1,3-thiazol-2-yl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(2,3-difluorophenyl)-(1,3-thiazol-2-yl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 63669287 |
| Molecular Formula | C13H14F2N2OS |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-[(2,3-difluorophenyl)-(1,3-thiazol-2-yl)methyl]-2-methoxyethanamine |
| SMILES | COCCNC(c1nccs1)c1cccc(F)c1F |
| InChI | InChI=1S/C13H14F2N2OS/c1-18-7-5-16-12(13-17-6-8-19-13)9-3-2-4-10(14)11(9)15/h2-4,6,8,12,16H,5,7H2,1H3 |
| InChIKey | CXRXVMIWQKRTHP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|