C14H17FN2O2S — CID 65101059
N-[(3-fluoro-4-methoxyphenyl)-(1,3-thiazol-2-yl)methyl]-2-methoxyethanamine (PubChem CID 65101059) has the molecular formula C14H17FN2O2S and a molecular weight of 296.37 g/mol. Its IUPAC name is N-[(3-fluoro-4-methoxyphenyl)-(1,3-thiazol-2-yl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(3-fluoro-4-methoxyphenyl)-(1,3-thiazol-2-yl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 65101059 |
| Molecular Formula | C14H17FN2O2S |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-[(3-fluoro-4-methoxyphenyl)-(1,3-thiazol-2-yl)methyl]-2-methoxyethanamine |
| SMILES | COCCNC(c1ccc(OC)c(F)c1)c1nccs1 |
| InChI | InChI=1S/C14H17FN2O2S/c1-18-7-5-16-13(14-17-6-8-20-14)10-3-4-12(19-2)11(15)9-10/h3-4,6,8-9,13,16H,5,7H2,1-2H3 |
| InChIKey | WKWFXPGZGKFNGL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|