C14H15FN4 — CID 63673453
5-fluoro-2-(4-imidazol-1-ylbutylamino)benzonitrile (PubChem CID 63673453) has the molecular formula C14H15FN4 and a molecular weight of 258.30 g/mol. Its IUPAC name is 5-fluoro-2-(4-imidazol-1-ylbutylamino)benzonitrile.
| Compound Name | 5-fluoro-2-(4-imidazol-1-ylbutylamino)benzonitrile |
|---|---|
| PubChem CID | 63673453 |
| Molecular Formula | C14H15FN4 |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 5-fluoro-2-(4-imidazol-1-ylbutylamino)benzonitrile |
| SMILES | N#Cc1cc(F)ccc1NCCCCn1ccnc1 |
| InChI | InChI=1S/C14H15FN4/c15-13-3-4-14(12(9-13)10-16)18-5-1-2-7-19-8-6-17-11-19/h3-4,6,8-9,11,18H,1-2,5,7H2 |
| InChIKey | GDMJCNJZNBKCDM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|