C18H12N2O2 — CID 636743
1,2-bis(1H-indol-3-yl)ethane-1,2-dione (PubChem CID 636743) has the molecular formula C18H12N2O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 1,2-bis(1H-indol-3-yl)ethane-1,2-dione.
| Compound Name | 1,2-bis(1H-indol-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 636743 |
| Molecular Formula | C18H12N2O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1,2-bis(1H-indol-3-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)c1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H12N2O2/c21-17(13-9-19-15-7-3-1-5-11(13)15)18(22)14-10-20-16-8-4-2-6-12(14)16/h1-10,19-20H |
| InChIKey | VOUJHLROTVTYMT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|