C15H24N2O3 — CID 63677111
N-ethyl-1-(3-methoxy-4-nitrophenyl)-3,3-dimethylbutan-2-amine (PubChem CID 63677111) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is N-ethyl-1-(3-methoxy-4-nitrophenyl)-3,3-dimethylbutan-2-amine.
| Compound Name | N-ethyl-1-(3-methoxy-4-nitrophenyl)-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 63677111 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | N-ethyl-1-(3-methoxy-4-nitrophenyl)-3,3-dimethylbutan-2-amine |
| SMILES | CCNC(Cc1ccc([N+](=O)[O-])c(OC)c1)C(C)(C)C |
| InChI | InChI=1S/C15H24N2O3/c1-6-16-14(15(2,3)4)10-11-7-8-12(17(18)19)13(9-11)20-5/h7-9,14,16H,6,10H2,1-5H3 |
| InChIKey | ORRMQSFPJWCLMJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|