C16H26N2O3 — CID 83003499
N,3,3-trimethyl-1-(4-nitro-3-propan-2-yloxyphenyl)butan-2-amine (PubChem CID 83003499) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is N,3,3-trimethyl-1-(4-nitro-3-propan-2-yloxyphenyl)butan-2-amine.
| Compound Name | N,3,3-trimethyl-1-(4-nitro-3-propan-2-yloxyphenyl)butan-2-amine |
|---|---|
| PubChem CID | 83003499 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N,3,3-trimethyl-1-(4-nitro-3-propan-2-yloxyphenyl)butan-2-amine |
| SMILES | CNC(Cc1ccc([N+](=O)[O-])c(OC(C)C)c1)C(C)(C)C |
| InChI | InChI=1S/C16H26N2O3/c1-11(2)21-14-9-12(7-8-13(14)18(19)20)10-15(17-6)16(3,4)5/h7-9,11,15,17H,10H2,1-6H3 |
| InChIKey | KTLHSQNDPDTTHG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|