C12H19ClF3NO — CID 63678864
3-chloro-N-(1-cyclopropylethyl)-2,2-dimethyl-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 63678864) has the molecular formula C12H19ClF3NO and a molecular weight of 285.74 g/mol. Its IUPAC name is 3-chloro-N-(1-cyclopropylethyl)-2,2-dimethyl-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 3-chloro-N-(1-cyclopropylethyl)-2,2-dimethyl-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 63678864 |
| Molecular Formula | C12H19ClF3NO |
| Molecular Weight | 285.74 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 3-chloro-N-(1-cyclopropylethyl)-2,2-dimethyl-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CC(C1CC1)N(CC(F)(F)F)C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C12H19ClF3NO/c1-8(9-4-5-9)17(7-12(14,15)16)10(18)11(2,3)6-13/h8-9H,4-7H2,1-3H3 |
| InChIKey | PCJUSTQBHLOGNH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.74 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|