C14H18F3N3O — CID 61106090
3,5-diamino-N-(1-cyclopropylethyl)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 61106090) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is 3,5-diamino-N-(1-cyclopropylethyl)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3,5-diamino-N-(1-cyclopropylethyl)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 61106090 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3,5-diamino-N-(1-cyclopropylethyl)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CC(C1CC1)N(CC(F)(F)F)C(=O)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C14H18F3N3O/c1-8(9-2-3-9)20(7-14(15,16)17)13(21)10-4-11(18)6-12(19)5-10/h4-6,8-9H,2-3,7,18-19H2,1H3 |
| InChIKey | DEGVRTSCALSKQY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|