C14H16ClF3N2O — CID 61106833
2-amino-4-chloro-N-(1-cyclopropylethyl)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 61106833) has the molecular formula C14H16ClF3N2O and a molecular weight of 320.74 g/mol. Its IUPAC name is 2-amino-4-chloro-N-(1-cyclopropylethyl)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-amino-4-chloro-N-(1-cyclopropylethyl)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 61106833 |
| Molecular Formula | C14H16ClF3N2O |
| Molecular Weight | 320.74 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-amino-4-chloro-N-(1-cyclopropylethyl)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CC(C1CC1)N(CC(F)(F)F)C(=O)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C14H16ClF3N2O/c1-8(9-2-3-9)20(7-14(16,17)18)13(21)11-5-4-10(15)6-12(11)19/h4-6,8-9H,2-3,7,19H2,1H3 |
| InChIKey | NFECPROYGFXYGV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.74 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|