C13H13F5N2O — CID 105380482
N-(1-cyclopropylethyl)-2,3-difluoro-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide (PubChem CID 105380482) has the molecular formula C13H13F5N2O and a molecular weight of 308.25 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-2,3-difluoro-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide.
| Compound Name | N-(1-cyclopropylethyl)-2,3-difluoro-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105380482 |
| Molecular Formula | C13H13F5N2O |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | N-(1-cyclopropylethyl)-2,3-difluoro-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide |
| SMILES | CC(C1CC1)N(CC(F)(F)F)C(=O)c1ccnc(F)c1F |
| InChI | InChI=1S/C13H13F5N2O/c1-7(8-2-3-8)20(6-13(16,17)18)12(21)9-4-5-19-11(15)10(9)14/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | RNYWKNSFNIGYHQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|