C15H20Cl2N2 — CID 63681809
N-(2-bicyclo[2.2.1]heptanylmethyl)-3-chloro-5-(chloromethyl)-N-methylpyridin-2-amine (PubChem CID 63681809) has the molecular formula C15H20Cl2N2 and a molecular weight of 299.25 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanylmethyl)-3-chloro-5-(chloromethyl)-N-methylpyridin-2-amine.
| Compound Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-3-chloro-5-(chloromethyl)-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 63681809 |
| Molecular Formula | C15H20Cl2N2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-3-chloro-5-(chloromethyl)-N-methylpyridin-2-amine |
| SMILES | CN(CC1CC2CCC1C2)c1ncc(CCl)cc1Cl |
| InChI | InChI=1S/C15H20Cl2N2/c1-19(9-13-5-10-2-3-12(13)4-10)15-14(17)6-11(7-16)8-18-15/h6,8,10,12-13H,2-5,7,9H2,1H3 |
| InChIKey | JCFNAXTVXFMOCT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|