C13H18ClN3 — CID 63686843
N-(2-bicyclo[2.2.1]heptanylmethyl)-6-chloro-N-methylpyrimidin-4-amine (PubChem CID 63686843) has the molecular formula C13H18ClN3 and a molecular weight of 251.76 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanylmethyl)-6-chloro-N-methylpyrimidin-4-amine.
| Compound Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-6-chloro-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 63686843 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-6-chloro-N-methylpyrimidin-4-amine |
| SMILES | CN(CC1CC2CCC1C2)c1cc(Cl)ncn1 |
| InChI | InChI=1S/C13H18ClN3/c1-17(13-6-12(14)15-8-16-13)7-11-5-9-2-3-10(11)4-9/h6,8-11H,2-5,7H2,1H3 |
| InChIKey | CXFGXVYCQLTNOF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |