C17H24N2O — CID 63683495
(2R)-2-amino-N-(2-bicyclo[2.2.1]heptanylmethyl)-3-phenylpropanamide (PubChem CID 63683495) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is (2R)-2-amino-N-(2-bicyclo[2.2.1]heptanylmethyl)-3-phenylpropanamide.
| Compound Name | (2R)-2-amino-N-(2-bicyclo[2.2.1]heptanylmethyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 63683495 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (2R)-2-amino-N-(2-bicyclo[2.2.1]heptanylmethyl)-3-phenylpropanamide |
| SMILES | N[C@H](Cc1ccccc1)C(=O)NCC1CC2CCC1C2 |
| InChI | InChI=1S/C17H24N2O/c18-16(10-12-4-2-1-3-5-12)17(20)19-11-15-9-13-6-7-14(15)8-13/h1-5,13-16H,6-11,18H2,(H,19,20)/t13?,14?,15?,16-/m1/s1 |
| InChIKey | WPNAEHGLPLUZJU-LGGPCSOHSA-N |
| XLogP | 2.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |