C13H12F3NO3 — CID 63687625
2-[cyclopropyl(formyl)amino]-2-[2-(trifluoromethyl)phenyl]acetic acid (PubChem CID 63687625) has the molecular formula C13H12F3NO3 and a molecular weight of 287.24 g/mol. Its IUPAC name is 2-[cyclopropyl(formyl)amino]-2-[2-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-[cyclopropyl(formyl)amino]-2-[2-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 63687625 |
| Molecular Formula | C13H12F3NO3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-[cyclopropyl(formyl)amino]-2-[2-(trifluoromethyl)phenyl]acetic acid |
| SMILES | O=CN(C1CC1)C(C(=O)O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H12F3NO3/c14-13(15,16)10-4-2-1-3-9(10)11(12(19)20)17(7-18)8-5-6-8/h1-4,7-8,11H,5-6H2,(H,19,20) |
| InChIKey | DSNJQFHXHQAQIK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|