C11H21NO4 — CID 63689061
2-[ethyl(formyl)amino]-4-methoxy-2,4-dimethylpentanoic acid (PubChem CID 63689061) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is 2-[ethyl(formyl)amino]-4-methoxy-2,4-dimethylpentanoic acid.
| Compound Name | 2-[ethyl(formyl)amino]-4-methoxy-2,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 63689061 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 2-[ethyl(formyl)amino]-4-methoxy-2,4-dimethylpentanoic acid |
| SMILES | CCN(C=O)C(C)(CC(C)(C)OC)C(=O)O |
| InChI | InChI=1S/C11H21NO4/c1-6-12(8-13)11(4,9(14)15)7-10(2,3)16-5/h8H,6-7H2,1-5H3,(H,14,15) |
| InChIKey | FBVHXYFVVFGTOI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|