About 4-methoxy-2,4-dimethyl-2-methylsulfanylpentanoic acid
4-methoxy-2,4-dimethyl-2-methylsulfanylpentanoic acid (PubChem CID 114989365) has the molecular formula C9H18O3S
and a molecular weight of 206.31 g/mol. Its IUPAC name is 4-methoxy-2,4-dimethyl-2-methylsulfanylpentanoic acid.
Molecular Properties
| Compound Name | 4-methoxy-2,4-dimethyl-2-methylsulfanylpentanoic acid |
| PubChem CID | 114989365 |
| Molecular Formula | C9H18O3S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 4-methoxy-2,4-dimethyl-2-methylsulfanylpentanoic acid |
| SMILES | COC(C)(C)CC(C)(SC)C(=O)O |
| InChI | InChI=1S/C9H18O3S/c1-8(2,12-4)6-9(3,13-5)7(10)11/h6H2,1-5H3,(H,10,11) |
| InChIKey | PTEYXYGGEXSIHS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-2,4-dimethyl-2-methylsulfanylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2,4-dimethyl-2-methylsulfanylpentanoic acid?
The IUPAC name of 4-methoxy-2,4-dimethyl-2-methylsulfanylpentanoic acid (CID 114989365) is 4-methoxy-2,4-dimethyl-2-methylsulfanylpentanoic acid.
What is the SMILES notation for 4-methoxy-2,4-dimethyl-2-methylsulfanylpentanoic acid?
The canonical SMILES for 4-methoxy-2,4-dimethyl-2-methylsulfanylpentanoic acid is COC(C)(C)CC(C)(SC)C(=O)O.
What is the InChIKey of 4-methoxy-2,4-dimethyl-2-methylsulfanylpentanoic acid?
The InChIKey is PTEYXYGGEXSIHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3S/c1-8(2,12-4)6-9(3,13-5)7(10)11/h6H2,1-5H3,(H,10,11).
What are the key properties of 4-methoxy-2,4-dimethyl-2-methylsulfanylpentanoic acid?
4-methoxy-2,4-dimethyl-2-methylsulfanylpentanoic acid has a molecular weight of 206.31 g/mol, XLogP of 2.01, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,4-dimethyl-2-methylsulfanylpentanoic acid is sourced from PubChem (CID 114989365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).