C13H17NO5 — CID 63689078
2-(2,5-dimethoxyphenyl)-2-[formyl(methyl)amino]propanoic acid (PubChem CID 63689078) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-2-[formyl(methyl)amino]propanoic acid.
| Compound Name | 2-(2,5-dimethoxyphenyl)-2-[formyl(methyl)amino]propanoic acid |
|---|---|
| PubChem CID | 63689078 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-2-[formyl(methyl)amino]propanoic acid |
| SMILES | COc1ccc(OC)c(C(C)(C(=O)O)N(C)C=O)c1 |
| InChI | InChI=1S/C13H17NO5/c1-13(12(16)17,14(2)8-15)10-7-9(18-3)5-6-11(10)19-4/h5-8H,1-4H3,(H,16,17) |
| InChIKey | PHWBBUXDXHUDTE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|