C13H22ClN5O — CID 63690083
4-chloro-N-(2-ethoxyethyl)-N-ethyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 63690083) has the molecular formula C13H22ClN5O and a molecular weight of 299.81 g/mol. Its IUPAC name is 4-chloro-N-(2-ethoxyethyl)-N-ethyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(2-ethoxyethyl)-N-ethyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63690083 |
| Molecular Formula | C13H22ClN5O |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 4-chloro-N-(2-ethoxyethyl)-N-ethyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | CCOCCN(CC)c1nc(Cl)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C13H22ClN5O/c1-3-18(9-10-20-4-2)12-15-11(14)16-13(17-12)19-7-5-6-8-19/h3-10H2,1-2H3 |
| InChIKey | QTTCCIVQFRULEH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|