C13H26N6O — CID 80833994
2-N-(2-ethoxyethyl)-2-N,4-N,4-N-triethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80833994) has the molecular formula C13H26N6O and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-N-(2-ethoxyethyl)-2-N,4-N,4-N-triethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(2-ethoxyethyl)-2-N,4-N,4-N-triethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80833994 |
| Molecular Formula | C13H26N6O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 2-N-(2-ethoxyethyl)-2-N,4-N,4-N-triethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCOCCN(CC)c1nc(N)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C13H26N6O/c1-5-18(6-2)12-15-11(14)16-13(17-12)19(7-3)9-10-20-8-4/h5-10H2,1-4H3,(H2,14,15,16,17) |
| InChIKey | JBLPPPFQPTYRSG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|