C14H22N4OS — CID 63692488
2-[[2-ethoxyethyl(ethyl)amino]methyl]-N-methylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 63692488) has the molecular formula C14H22N4OS and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-[[2-ethoxyethyl(ethyl)amino]methyl]-N-methylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[[2-ethoxyethyl(ethyl)amino]methyl]-N-methylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 63692488 |
| Molecular Formula | C14H22N4OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-[[2-ethoxyethyl(ethyl)amino]methyl]-N-methylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCOCCN(CC)Cc1nc(NC)c2ccsc2n1 |
| InChI | InChI=1S/C14H22N4OS/c1-4-18(7-8-19-5-2)10-12-16-13(15-3)11-6-9-20-14(11)17-12/h6,9H,4-5,7-8,10H2,1-3H3,(H,15,16,17) |
| InChIKey | XTPHOHFDGPMQSP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|