C12H20BrN3 — CID 63693227
2-bromo-1-N-[3-(dimethylamino)propyl]-1-N-methylbenzene-1,4-diamine (PubChem CID 63693227) has the molecular formula C12H20BrN3 and a molecular weight of 286.22 g/mol. Its IUPAC name is 2-bromo-1-N-[3-(dimethylamino)propyl]-1-N-methylbenzene-1,4-diamine.
| Compound Name | 2-bromo-1-N-[3-(dimethylamino)propyl]-1-N-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 63693227 |
| Molecular Formula | C12H20BrN3 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-bromo-1-N-[3-(dimethylamino)propyl]-1-N-methylbenzene-1,4-diamine |
| SMILES | CN(C)CCCN(C)c1ccc(N)cc1Br |
| InChI | InChI=1S/C12H20BrN3/c1-15(2)7-4-8-16(3)12-6-5-10(14)9-11(12)13/h5-6,9H,4,7-8,14H2,1-3H3 |
| InChIKey | PWZPZKKQJHLBSY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|