C9H12N2O2S — CID 63697970
ethyl 3-pyrimidin-4-ylsulfanylpropanoate (PubChem CID 63697970) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is ethyl 3-pyrimidin-4-ylsulfanylpropanoate.
| Compound Name | ethyl 3-pyrimidin-4-ylsulfanylpropanoate |
|---|---|
| PubChem CID | 63697970 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | ethyl 3-pyrimidin-4-ylsulfanylpropanoate |
| SMILES | CCOC(=O)CCSc1ccncn1 |
| InChI | InChI=1S/C9H12N2O2S/c1-2-13-9(12)4-6-14-8-3-5-10-7-11-8/h3,5,7H,2,4,6H2,1H3 |
| InChIKey | OXQCXVMJHADOLB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |