C13H17N3O5S — CID 3058459
ethyl 3-[6-[(2-ethoxy-2-oxoacetyl)amino]pyrimidin-4-yl]sulfanylpropanoate (PubChem CID 3058459) has the molecular formula C13H17N3O5S and a molecular weight of 327.36 g/mol. Its IUPAC name is ethyl 3-[6-[(2-ethoxy-2-oxoacetyl)amino]pyrimidin-4-yl]sulfanylpropanoate.
| Compound Name | ethyl 3-[6-[(2-ethoxy-2-oxoacetyl)amino]pyrimidin-4-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 3058459 |
| Molecular Formula | C13H17N3O5S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | ethyl 3-[6-[(2-ethoxy-2-oxoacetyl)amino]pyrimidin-4-yl]sulfanylpropanoate |
| SMILES | CCOC(=O)CCSc1cc(NC(=O)C(=O)OCC)ncn1 |
| InChI | InChI=1S/C13H17N3O5S/c1-3-20-11(17)5-6-22-10-7-9(14-8-15-10)16-12(18)13(19)21-4-2/h7-8H,3-6H2,1-2H3,(H,14,15,16,18) |
| InChIKey | GTYDIXVGSWIJOW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|