4,4,4-trifluoro-3-[methyl(oxan-4-ylmethyl)amino]butanoic acid

C11H18F3NO3 — CID 63707539

IUPAC4,4,4-trifluoro-3-[methyl(oxan-4-ylmethyl)amino]butanoic acid
SMILESCN(CC1CCOCC1)C(CC(=O)O)C(F)(F)F
InChIInChI=1S/C11H18F3NO3/c1-15(7-8-2-4-18-5-3-8)9(6-10(16)17)11(12,13)14/h8-9H,2-7H2,1H3,(H,16,17)
InChIKeyJUZQRGRRLXQZLW-UHFFFAOYSA-N
MW269.26 g/mol
LogP1.75
Rot. Bonds5

About 4,4,4-trifluoro-3-[methyl(oxan-4-ylmethyl)amino]butanoic acid

4,4,4-trifluoro-3-[methyl(oxan-4-ylmethyl)amino]butanoic acid (PubChem CID 63707539) has the molecular formula C11H18F3NO3 and a molecular weight of 269.26 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-[methyl(oxan-4-ylmethyl)amino]butanoic acid.

Molecular Properties

Compound Name4,4,4-trifluoro-3-[methyl(oxan-4-ylmethyl)amino]butanoic acid
PubChem CID63707539
Molecular FormulaC11H18F3NO3
Molecular Weight269.26 g/mol
Exact Mass269.12
IUPAC Name4,4,4-trifluoro-3-[methyl(oxan-4-ylmethyl)amino]butanoic acid
SMILESCN(CC1CCOCC1)C(CC(=O)O)C(F)(F)F
InChIInChI=1S/C11H18F3NO3/c1-15(7-8-2-4-18-5-3-8)9(6-10(16)17)11(12,13)14/h8-9H,2-7H2,1H3,(H,16,17)
InChIKeyJUZQRGRRLXQZLW-UHFFFAOYSA-N
XLogP1.75
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.26
LogP ≤ 51.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4,4,4-trifluoro-3-[methyl(oxan-4-ylmethyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,4,4-trifluoro-3-[methyl(oxan-4-ylmethyl)amino]butanoic acid?
The IUPAC name of 4,4,4-trifluoro-3-[methyl(oxan-4-ylmethyl)amino]butanoic acid (CID 63707539) is 4,4,4-trifluoro-3-[methyl(oxan-4-ylmethyl)amino]butanoic acid.
What is the SMILES notation for 4,4,4-trifluoro-3-[methyl(oxan-4-ylmethyl)amino]butanoic acid?
The canonical SMILES for 4,4,4-trifluoro-3-[methyl(oxan-4-ylmethyl)amino]butanoic acid is CN(CC1CCOCC1)C(CC(=O)O)C(F)(F)F.
What is the InChIKey of 4,4,4-trifluoro-3-[methyl(oxan-4-ylmethyl)amino]butanoic acid?
The InChIKey is JUZQRGRRLXQZLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO3/c1-15(7-8-2-4-18-5-3-8)9(6-10(16)17)11(12,13)14/h8-9H,2-7H2,1H3,(H,16,17).
What are the key properties of 4,4,4-trifluoro-3-[methyl(oxan-4-ylmethyl)amino]butanoic acid?
4,4,4-trifluoro-3-[methyl(oxan-4-ylmethyl)amino]butanoic acid has a molecular weight of 269.26 g/mol, XLogP of 1.75, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4,4-trifluoro-3-[methyl(oxan-4-ylmethyl)amino]butanoic acid is sourced from PubChem (CID 63707539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).