C10H18F3NO2 — CID 63067747
4,4,4-trifluoro-3-[methyl(2-methylbutyl)amino]butanoic acid (PubChem CID 63067747) has the molecular formula C10H18F3NO2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-[methyl(2-methylbutyl)amino]butanoic acid.
| Compound Name | 4,4,4-trifluoro-3-[methyl(2-methylbutyl)amino]butanoic acid |
|---|---|
| PubChem CID | 63067747 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 4,4,4-trifluoro-3-[methyl(2-methylbutyl)amino]butanoic acid |
| SMILES | CCC(C)CN(C)C(CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C10H18F3NO2/c1-4-7(2)6-14(3)8(5-9(15)16)10(11,12)13/h7-8H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | BHUMSNLGPIJUEK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |