C10H17F3N2O3 — CID 167791495
3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid (PubChem CID 167791495) has the molecular formula C10H17F3N2O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is 3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid.
| Compound Name | 3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 167791495 |
| Molecular Formula | C10H17F3N2O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid |
| SMILES | CCN(CC)C(=O)N(C)C(CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O3/c1-4-15(5-2)9(18)14(3)7(6-8(16)17)10(11,12)13/h7H,4-6H2,1-3H3,(H,16,17) |
| InChIKey | MNPZTCKNGJFTGD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |