3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid

C10H17F3N2O3 — CID 167791495

IUPAC3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid
SMILESCCN(CC)C(=O)N(C)C(CC(=O)O)C(F)(F)F
InChIInChI=1S/C10H17F3N2O3/c1-4-15(5-2)9(18)14(3)7(6-8(16)17)10(11,12)13/h7H,4-6H2,1-3H3,(H,16,17)
InChIKeyMNPZTCKNGJFTGD-UHFFFAOYSA-N
MW270.25 g/mol
LogP1.79
Rot. Bonds5

About 3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid

3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid (PubChem CID 167791495) has the molecular formula C10H17F3N2O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is 3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid.

Molecular Properties

Compound Name3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid
PubChem CID167791495
Molecular FormulaC10H17F3N2O3
Molecular Weight270.25 g/mol
Exact Mass270.12
IUPAC Name3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid
SMILESCCN(CC)C(=O)N(C)C(CC(=O)O)C(F)(F)F
InChIInChI=1S/C10H17F3N2O3/c1-4-15(5-2)9(18)14(3)7(6-8(16)17)10(11,12)13/h7H,4-6H2,1-3H3,(H,16,17)
InChIKeyMNPZTCKNGJFTGD-UHFFFAOYSA-N
XLogP1.79
TPSA60.85 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.25
LogP ≤ 51.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid?
The IUPAC name of 3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid (CID 167791495) is 3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid.
What is the SMILES notation for 3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid?
The canonical SMILES for 3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid is CCN(CC)C(=O)N(C)C(CC(=O)O)C(F)(F)F.
What is the InChIKey of 3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid?
The InChIKey is MNPZTCKNGJFTGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N2O3/c1-4-15(5-2)9(18)14(3)7(6-8(16)17)10(11,12)13/h7H,4-6H2,1-3H3,(H,16,17).
What are the key properties of 3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid?
3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid has a molecular weight of 270.25 g/mol, XLogP of 1.79, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[diethylcarbamoyl(methyl)amino]-4,4,4-trifluorobutanoic acid is sourced from PubChem (CID 167791495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).