C17H15N3O — CID 63708320
5-(3,4-dihydro-2H-chromen-4-yl)-3-phenyl-1H-1,2,4-triazole (PubChem CID 63708320) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-chromen-4-yl)-3-phenyl-1H-1,2,4-triazole.
| Compound Name | 5-(3,4-dihydro-2H-chromen-4-yl)-3-phenyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 63708320 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 5-(3,4-dihydro-2H-chromen-4-yl)-3-phenyl-1H-1,2,4-triazole |
| SMILES | c1ccc(-c2n[nH]c(C3CCOc4ccccc43)n2)cc1 |
| InChI | InChI=1S/C17H15N3O/c1-2-6-12(7-3-1)16-18-17(20-19-16)14-10-11-21-15-9-5-4-8-13(14)15/h1-9,14H,10-11H2,(H,18,19,20) |
| InChIKey | YMOXPCGEZKMVQI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |