C13H20F3N3O2 — CID 63709308
N-methyl-1-[3-(trifluoromethyl)pyrrolidine-3-carbonyl]piperidine-4-carboxamide (PubChem CID 63709308) has the molecular formula C13H20F3N3O2 and a molecular weight of 307.32 g/mol. Its IUPAC name is N-methyl-1-[3-(trifluoromethyl)pyrrolidine-3-carbonyl]piperidine-4-carboxamide.
| Compound Name | N-methyl-1-[3-(trifluoromethyl)pyrrolidine-3-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 63709308 |
| Molecular Formula | C13H20F3N3O2 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | N-methyl-1-[3-(trifluoromethyl)pyrrolidine-3-carbonyl]piperidine-4-carboxamide |
| SMILES | CNC(=O)C1CCN(C(=O)C2(C(F)(F)F)CCNC2)CC1 |
| InChI | InChI=1S/C13H20F3N3O2/c1-17-10(20)9-2-6-19(7-3-9)11(21)12(13(14,15)16)4-5-18-8-12/h9,18H,2-8H2,1H3,(H,17,20) |
| InChIKey | VTSIQPNBJAHKEX-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |