C16H20O2 — CID 63709562
cyclohexen-1-yl(3,4-dihydro-2H-chromen-4-yl)methanol (PubChem CID 63709562) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is cyclohexen-1-yl(3,4-dihydro-2H-chromen-4-yl)methanol.
| Compound Name | cyclohexen-1-yl(3,4-dihydro-2H-chromen-4-yl)methanol |
|---|---|
| PubChem CID | 63709562 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | cyclohexen-1-yl(3,4-dihydro-2H-chromen-4-yl)methanol |
| SMILES | OC(C1=CCCCC1)C1CCOc2ccccc21 |
| InChI | InChI=1S/C16H20O2/c17-16(12-6-2-1-3-7-12)14-10-11-18-15-9-5-4-8-13(14)15/h4-6,8-9,14,16-17H,1-3,7,10-11H2 |
| InChIKey | GKYHJSRXIJYCRY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|