C13H14O2 — CID 65411928
1-(3,4-dihydro-2H-chromen-4-yl)but-3-yn-1-ol (PubChem CID 65411928) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)but-3-yn-1-ol.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)but-3-yn-1-ol |
|---|---|
| PubChem CID | 65411928 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)but-3-yn-1-ol |
| SMILES | C#CCC(O)C1CCOc2ccccc21 |
| InChI | InChI=1S/C13H14O2/c1-2-5-12(14)10-8-9-15-13-7-4-3-6-11(10)13/h1,3-4,6-7,10,12,14H,5,8-9H2 |
| InChIKey | FRYKMTLRCHOWRG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|