C11H13NO3 — CID 57342248
(4S)-4-[(1R)-1-nitroethyl]-3,4-dihydro-2H-chromene (PubChem CID 57342248) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is (4S)-4-[(1R)-1-nitroethyl]-3,4-dihydro-2H-chromene.
| Compound Name | (4S)-4-[(1R)-1-nitroethyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 57342248 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (4S)-4-[(1R)-1-nitroethyl]-3,4-dihydro-2H-chromene |
| SMILES | C[C@H]([C@H]1CCOc2ccccc21)[N+](=O)[O-] |
| InChI | InChI=1S/C11H13NO3/c1-8(12(13)14)9-6-7-15-11-5-3-2-4-10(9)11/h2-5,8-9H,6-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | NEABTQSCCXRWGQ-RKDXNWHRSA-N |
| XLogP | 2.22 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|