C12H15NO3 — CID 57342249
(4S)-4-[(1R)-1-nitropropyl]-3,4-dihydro-2H-chromene (PubChem CID 57342249) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is (4S)-4-[(1R)-1-nitropropyl]-3,4-dihydro-2H-chromene.
| Compound Name | (4S)-4-[(1R)-1-nitropropyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 57342249 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (4S)-4-[(1R)-1-nitropropyl]-3,4-dihydro-2H-chromene |
| SMILES | CC[C@H]([C@H]1CCOc2ccccc21)[N+](=O)[O-] |
| InChI | InChI=1S/C12H15NO3/c1-2-11(13(14)15)9-7-8-16-12-6-4-3-5-10(9)12/h3-6,9,11H,2,7-8H2,1H3/t9-,11+/m0/s1 |
| InChIKey | RNZIUKZTZQVPRO-GXSJLCMTSA-N |
| XLogP | 2.61 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|