C11H15F3N2O4S — CID 63709781
1-[3-(2-amino-2-oxoethyl)sulfanylpropanoyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 63709781) has the molecular formula C11H15F3N2O4S and a molecular weight of 328.31 g/mol. Its IUPAC name is 1-[3-(2-amino-2-oxoethyl)sulfanylpropanoyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[3-(2-amino-2-oxoethyl)sulfanylpropanoyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63709781 |
| Molecular Formula | C11H15F3N2O4S |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 1-[3-(2-amino-2-oxoethyl)sulfanylpropanoyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | NC(=O)CSCCC(=O)N1CCC(C(=O)O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H15F3N2O4S/c12-11(13,14)10(9(19)20)2-3-16(6-10)8(18)1-4-21-5-7(15)17/h1-6H2,(H2,15,17)(H,19,20) |
| InChIKey | GOVAMPCYEQFQEP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|