C10H14F3NO3S — CID 63708345
1-(3-methylsulfanylpropanoyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 63708345) has the molecular formula C10H14F3NO3S and a molecular weight of 285.29 g/mol. Its IUPAC name is 1-(3-methylsulfanylpropanoyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(3-methylsulfanylpropanoyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63708345 |
| Molecular Formula | C10H14F3NO3S |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 1-(3-methylsulfanylpropanoyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | CSCCC(=O)N1CCC(C(=O)O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H14F3NO3S/c1-18-5-2-7(15)14-4-3-9(6-14,8(16)17)10(11,12)13/h2-6H2,1H3,(H,16,17) |
| InChIKey | XHWXRIIHHLWZFS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |