C11H13F3N2O2 — CID 63710906
N-(furan-2-ylmethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide (PubChem CID 63710906) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 63710906 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1ccco1)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C11H13F3N2O2/c12-11(13,14)10(3-4-15-7-10)9(17)16-6-8-2-1-5-18-8/h1-2,5,15H,3-4,6-7H2,(H,16,17) |
| InChIKey | JNFXNXALHLXKPW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |