C14H17FN2O3 — CID 63715623
methyl 4-fluoro-2-[(4-methylpyrrolidine-3-carbonyl)amino]benzoate (PubChem CID 63715623) has the molecular formula C14H17FN2O3 and a molecular weight of 280.30 g/mol. Its IUPAC name is methyl 4-fluoro-2-[(4-methylpyrrolidine-3-carbonyl)amino]benzoate.
| Compound Name | methyl 4-fluoro-2-[(4-methylpyrrolidine-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 63715623 |
| Molecular Formula | C14H17FN2O3 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | methyl 4-fluoro-2-[(4-methylpyrrolidine-3-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(F)cc1NC(=O)C1CNCC1C |
| InChI | InChI=1S/C14H17FN2O3/c1-8-6-16-7-11(8)13(18)17-12-5-9(15)3-4-10(12)14(19)20-2/h3-5,8,11,16H,6-7H2,1-2H3,(H,17,18) |
| InChIKey | YUFSBIMJJRLERU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |