About 4-phenylmethoxyazepane
4-phenylmethoxyazepane (PubChem CID 63716383) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 4-phenylmethoxyazepane.
Molecular Properties
| Compound Name | 4-phenylmethoxyazepane |
| PubChem CID | 63716383 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 4-phenylmethoxyazepane |
| SMILES | c1ccc(COC2CCCNCC2)cc1 |
| InChI | InChI=1S/C13H19NO/c1-2-5-12(6-3-1)11-15-13-7-4-9-14-10-8-13/h1-3,5-6,13-14H,4,7-11H2 |
| InChIKey | QZYFNCLJBXXYFP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenylmethoxyazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylmethoxyazepane?
The IUPAC name of 4-phenylmethoxyazepane (CID 63716383) is 4-phenylmethoxyazepane.
What is the SMILES notation for 4-phenylmethoxyazepane?
The canonical SMILES for 4-phenylmethoxyazepane is c1ccc(COC2CCCNCC2)cc1.
What is the InChIKey of 4-phenylmethoxyazepane?
The InChIKey is QZYFNCLJBXXYFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-2-5-12(6-3-1)11-15-13-7-4-9-14-10-8-13/h1-3,5-6,13-14H,4,7-11H2.
What are the key properties of 4-phenylmethoxyazepane?
4-phenylmethoxyazepane has a molecular weight of 205.30 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylmethoxyazepane is sourced from PubChem (CID 63716383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).