C14H22N2OS — CID 63716522
4-methyl-N-(1-thiophen-2-ylbutyl)pyrrolidine-3-carboxamide (PubChem CID 63716522) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is 4-methyl-N-(1-thiophen-2-ylbutyl)pyrrolidine-3-carboxamide.
| Compound Name | 4-methyl-N-(1-thiophen-2-ylbutyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 63716522 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4-methyl-N-(1-thiophen-2-ylbutyl)pyrrolidine-3-carboxamide |
| SMILES | CCCC(NC(=O)C1CNCC1C)c1cccs1 |
| InChI | InChI=1S/C14H22N2OS/c1-3-5-12(13-6-4-7-18-13)16-14(17)11-9-15-8-10(11)2/h4,6-7,10-12,15H,3,5,8-9H2,1-2H3,(H,16,17) |
| InChIKey | YKPSKBLGYSPPJO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |